About 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid
5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid (PubChem CID 14953067) has the molecular formula C21H22ClFN2O2
and a molecular weight of 388.87 g/mol. Its IUPAC name is 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid |
| PubChem CID | 14953067 |
| Molecular Formula | C21H22ClFN2O2 |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)Cc1nc2cc(F)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClFN2O2/c1-21(2,10-9-20(26)27)12-19-24-17-11-16(23)7-8-18(17)25(19)13-14-3-5-15(22)6-4-14/h3-8,11H,9-10,12-13H2,1-2H3,(H,26,27) |
| InChIKey | JPRTVHFLAMHWIX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid?
The IUPAC name of 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid (CID 14953067) is 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid.
What is the SMILES notation for 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid?
The canonical SMILES for 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid is CC(C)(CCC(=O)O)Cc1nc2cc(F)ccc2n1Cc1ccc(Cl)cc1.
What is the InChIKey of 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid?
The InChIKey is JPRTVHFLAMHWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClFN2O2/c1-21(2,10-9-20(26)27)12-19-24-17-11-16(23)7-8-18(17)25(19)13-14-3-5-15(22)6-4-14/h3-8,11H,9-10,12-13H2,1-2H3,(H,26,27).
What are the key properties of 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid?
5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid has a molecular weight of 388.87 g/mol, XLogP of 5.31, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(4-chlorophenyl)methyl]-5-fluorobenzimidazol-2-yl]-4,4-dimethylpentanoic acid is sourced from PubChem (CID 14953067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).