About 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid
4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid (PubChem CID 14953090) has the molecular formula C21H23FN2O3
and a molecular weight of 370.42 g/mol. Its IUPAC name is 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid |
| PubChem CID | 14953090 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid |
| SMILES | COc1ccc(Cn2c(CC(C)(C)CC(=O)O)nc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C21H23FN2O3/c1-21(2,12-20(25)26)11-19-23-17-10-15(22)6-9-18(17)24(19)13-14-4-7-16(27-3)8-5-14/h4-10H,11-13H2,1-3H3,(H,25,26) |
| InChIKey | HGJHCDQVMUEIIK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid?
The IUPAC name of 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid (CID 14953090) is 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid.
What is the SMILES notation for 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid?
The canonical SMILES for 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid is COc1ccc(Cn2c(CC(C)(C)CC(=O)O)nc3cc(F)ccc32)cc1.
What is the InChIKey of 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid?
The InChIKey is HGJHCDQVMUEIIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN2O3/c1-21(2,12-20(25)26)11-19-23-17-10-15(22)6-9-18(17)24(19)13-14-4-7-16(27-3)8-5-14/h4-10H,11-13H2,1-3H3,(H,25,26).
What are the key properties of 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid?
4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid has a molecular weight of 370.42 g/mol, XLogP of 4.28, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-fluoro-1-[(4-methoxyphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoic acid is sourced from PubChem (CID 14953090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).