About 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine
1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine (PubChem CID 14953150) has the molecular formula C12H18N4O2S
and a molecular weight of 282.37 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine |
| PubChem CID | 14953150 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine |
| SMILES | CCOC(Cn1ncc2c(SC)ncnc21)OCC |
| InChI | InChI=1S/C12H18N4O2S/c1-4-17-10(18-5-2)7-16-11-9(6-15-16)12(19-3)14-8-13-11/h6,8,10H,4-5,7H2,1-3H3 |
| InChIKey | USFQSYVAFIDHER-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine?
The IUPAC name of 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine (CID 14953150) is 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine is CCOC(Cn1ncc2c(SC)ncnc21)OCC.
What is the InChIKey of 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine?
The InChIKey is USFQSYVAFIDHER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2S/c1-4-17-10(18-5-2)7-16-11-9(6-15-16)12(19-3)14-8-13-11/h6,8,10H,4-5,7H2,1-3H3.
What are the key properties of 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine?
1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine has a molecular weight of 282.37 g/mol, XLogP of 1.95, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-diethoxyethyl)-4-methylsulfanylpyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 14953150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).