C13H20N4O2S2 — CID 14953151
1-(2,2-diethoxyethyl)-4,6-bis(methylsulfanyl)pyrazolo[5,4-d]pyrimidine (PubChem CID 14953151) has the molecular formula C13H20N4O2S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-4,6-bis(methylsulfanyl)pyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-(2,2-diethoxyethyl)-4,6-bis(methylsulfanyl)pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 14953151 |
| Molecular Formula | C13H20N4O2S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-4,6-bis(methylsulfanyl)pyrazolo[5,4-d]pyrimidine |
| SMILES | CCOC(Cn1ncc2c(SC)nc(SC)nc21)OCC |
| InChI | InChI=1S/C13H20N4O2S2/c1-5-18-10(19-6-2)8-17-11-9(7-14-17)12(20-3)16-13(15-11)21-4/h7,10H,5-6,8H2,1-4H3 |
| InChIKey | IVAMJNQEUMYRFZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|