C15H24N4O2S2 — CID 14953152
1-(2,2-diethoxyethyl)-4,6-bis(ethylsulfanyl)pyrazolo[5,4-d]pyrimidine (PubChem CID 14953152) has the molecular formula C15H24N4O2S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-4,6-bis(ethylsulfanyl)pyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-(2,2-diethoxyethyl)-4,6-bis(ethylsulfanyl)pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 14953152 |
| Molecular Formula | C15H24N4O2S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-4,6-bis(ethylsulfanyl)pyrazolo[5,4-d]pyrimidine |
| SMILES | CCOC(Cn1ncc2c(SCC)nc(SCC)nc21)OCC |
| InChI | InChI=1S/C15H24N4O2S2/c1-5-20-12(21-6-2)10-19-13-11(9-16-19)14(22-7-3)18-15(17-13)23-8-4/h9,12H,5-8,10H2,1-4H3 |
| InChIKey | LDGFHULXUVZILQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|