About 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine
1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 14953171) has the molecular formula C12H19N5O3
and a molecular weight of 281.32 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 14953171 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCOC(Cn1ncc2c(N)nc(OC)nc21)OCC |
| InChI | InChI=1S/C12H19N5O3/c1-4-19-9(20-5-2)7-17-11-8(6-14-17)10(13)15-12(16-11)18-3/h6,9H,4-5,7H2,1-3H3,(H2,13,15,16) |
| InChIKey | GHDUIWMEWRVZBG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine (CID 14953171) is 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine is CCOC(Cn1ncc2c(N)nc(OC)nc21)OCC.
What is the InChIKey of 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is GHDUIWMEWRVZBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5O3/c1-4-19-9(20-5-2)7-17-11-8(6-14-17)10(13)15-12(16-11)18-3/h6,9H,4-5,7H2,1-3H3,(H2,13,15,16).
What are the key properties of 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine?
1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 281.32 g/mol, XLogP of 0.82, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-diethoxyethyl)-6-methoxypyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 14953171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).