C14H10FN5 — CID 14953221
10-[(2-fluorophenyl)methyl]-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 14953221) has the molecular formula C14H10FN5 and a molecular weight of 267.27 g/mol. Its IUPAC name is 10-[(2-fluorophenyl)methyl]-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-[(2-fluorophenyl)methyl]-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 14953221 |
| Molecular Formula | C14H10FN5 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 10-[(2-fluorophenyl)methyl]-3,6,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Fc1ccccc1Cn1ncc2c1ncn1ccnc21 |
| InChI | InChI=1S/C14H10FN5/c15-12-4-2-1-3-10(12)8-20-14-11(7-18-20)13-16-5-6-19(13)9-17-14/h1-7,9H,8H2 |
| InChIKey | ZCYKKHDLFSAQTB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |