C30H40N8O6P2 — CID 14953736
1-diethoxyphosphoryl-N-[(E)-[10-[(E)-[(1-diethoxyphosphoryl-4,5-dihydroimidazol-2-yl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]-4,5-dihydroimidazol-2-amine (PubChem CID 14953736) has the molecular formula C30H40N8O6P2 and a molecular weight of 670.65 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-[(E)-[10-[(E)-[(1-diethoxyphosphoryl-4,5-dihydroimidazol-2-yl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-diethoxyphosphoryl-N-[(E)-[10-[(E)-[(1-diethoxyphosphoryl-4,5-dihydroimidazol-2-yl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 14953736 |
| Molecular Formula | C30H40N8O6P2 |
| Molecular Weight | 670.65 g/mol |
| Exact Mass | 670.25 |
| IUPAC Name | 1-diethoxyphosphoryl-N-[(E)-[10-[(E)-[(1-diethoxyphosphoryl-4,5-dihydroimidazol-2-yl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]-4,5-dihydroimidazol-2-amine |
| SMILES | CCOP(=O)(OCC)N1CCN=C1N/N=C/c1c2ccccc2c(/C=N/NC2=NCCN2P(=O)(OCC)OCC)c2ccccc12 |
| InChI | InChI=1S/C30H40N8O6P2/c1-5-41-45(39,42-6-2)37-19-17-31-29(37)35-33-21-27-23-13-9-11-15-25(23)28(26-16-12-10-14-24(26)27)22-34-36-30-32-18-20-38(30)46(40,43-7-3)44-8-4/h9-16,21-22H,5-8,17-20H2,1-4H3,(H,31,35)(H,32,36)/b33-21+,34-22+ |
| InChIKey | AHADVOSCOJRDPV-WXGDAXOSSA-N |
| XLogP | 5.55 |
| TPSA | 151.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|