C26H31N8O3P — CID 14953740
1-diethoxyphosphoryl-N-[(E)-[10-[(E)-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)methyl]anthracen-9-yl]methylideneamino]-4,5-dihydroimidazol-2-amine (PubChem CID 14953740) has the molecular formula C26H31N8O3P and a molecular weight of 534.56 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-N-[(E)-[10-[(E)-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)methyl]anthracen-9-yl]methylideneamino]-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-diethoxyphosphoryl-N-[(E)-[10-[(E)-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)methyl]anthracen-9-yl]methylideneamino]-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 14953740 |
| Molecular Formula | C26H31N8O3P |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 1-diethoxyphosphoryl-N-[(E)-[10-[(E)-(4,5-dihydro-1H-imidazol-2-ylhydrazinylidene)methyl]anthracen-9-yl]methylideneamino]-4,5-dihydroimidazol-2-amine |
| SMILES | CCOP(=O)(OCC)N1CCN=C1N/N=C/c1c2ccccc2c(/C=N/NC2=NCCN2)c2ccccc12 |
| InChI | InChI=1S/C26H31N8O3P/c1-3-36-38(35,37-4-2)34-16-15-29-26(34)33-31-18-24-21-11-7-5-9-19(21)23(20-10-6-8-12-22(20)24)17-30-32-25-27-13-14-28-25/h5-12,17-18H,3-4,13-16H2,1-2H3,(H,29,33)(H2,27,28,32)/b30-17+,31-18+ |
| InChIKey | ZUYPDFDLQPZXHR-HRTPUDOWSA-N |
| XLogP | 3.65 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|