About (2-phenylquinolin-4-yl) methanesulfonate
(2-phenylquinolin-4-yl) methanesulfonate (PubChem CID 14954068) has the molecular formula C16H13NO3S
and a molecular weight of 299.35 g/mol. Its IUPAC name is (2-phenylquinolin-4-yl) methanesulfonate.
Molecular Properties
| Compound Name | (2-phenylquinolin-4-yl) methanesulfonate |
| PubChem CID | 14954068 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (2-phenylquinolin-4-yl) methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C16H13NO3S/c1-21(18,19)20-16-11-15(12-7-3-2-4-8-12)17-14-10-6-5-9-13(14)16/h2-11H,1H3 |
| InChIKey | UQTPUEQGSVGOIC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylquinolin-4-yl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylquinolin-4-yl) methanesulfonate?
The IUPAC name of (2-phenylquinolin-4-yl) methanesulfonate (CID 14954068) is (2-phenylquinolin-4-yl) methanesulfonate.
What is the SMILES notation for (2-phenylquinolin-4-yl) methanesulfonate?
The canonical SMILES for (2-phenylquinolin-4-yl) methanesulfonate is CS(=O)(=O)Oc1cc(-c2ccccc2)nc2ccccc12.
What is the InChIKey of (2-phenylquinolin-4-yl) methanesulfonate?
The InChIKey is UQTPUEQGSVGOIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3S/c1-21(18,19)20-16-11-15(12-7-3-2-4-8-12)17-14-10-6-5-9-13(14)16/h2-11H,1H3.
What are the key properties of (2-phenylquinolin-4-yl) methanesulfonate?
(2-phenylquinolin-4-yl) methanesulfonate has a molecular weight of 299.35 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylquinolin-4-yl) methanesulfonate is sourced from PubChem (CID 14954068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).