C18H26N2OS3 — CID 149555393
1-[5-(2-Methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8-sulfanyloctan-1-one (PubChem CID 149555393) has the molecular formula C18H26N2OS3 and a molecular weight of 382.60 g/mol. Its IUPAC name is 1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8-sulfanyloctan-1-one.
| Compound Name | 1-[5-(2-Methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8-sulfanyloctan-1-one |
|---|---|
| PubChem CID | 149555393 |
| Molecular Formula | C18H26N2OS3 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]-8-sulfanyloctan-1-one |
| SMILES | CC(C)CC1=C(N=C(S1)C2=NC=CS2)C(=O)CCCCCCCS |
| InChI | InChI=1S/C18H26N2OS3/c1-13(2)12-15-16(14(21)8-6-4-3-5-7-10-22)20-18(24-15)17-19-9-11-23-17/h9,11,13,22H,3-8,10,12H2,1-2H3 |
| InChIKey | ZRDURLDJZCDRSF-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | 381 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|