About prop-2-enoxymethyl acetate
prop-2-enoxymethyl acetate (PubChem CID 14955603) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is prop-2-enoxymethyl acetate.
Molecular Properties
| Compound Name | prop-2-enoxymethyl acetate |
| PubChem CID | 14955603 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | prop-2-enoxymethyl acetate |
| SMILES | C=CCOCOC(C)=O |
| InChI | InChI=1S/C6H10O3/c1-3-4-8-5-9-6(2)7/h3H,1,4-5H2,2H3 |
| InChIKey | NBGUSBVPRPLUON-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoxymethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoxymethyl acetate?
The IUPAC name of prop-2-enoxymethyl acetate (CID 14955603) is prop-2-enoxymethyl acetate.
What is the SMILES notation for prop-2-enoxymethyl acetate?
The canonical SMILES for prop-2-enoxymethyl acetate is C=CCOCOC(C)=O.
What is the InChIKey of prop-2-enoxymethyl acetate?
The InChIKey is NBGUSBVPRPLUON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c1-3-4-8-5-9-6(2)7/h3H,1,4-5H2,2H3.
What are the key properties of prop-2-enoxymethyl acetate?
prop-2-enoxymethyl acetate has a molecular weight of 130.14 g/mol, XLogP of 0.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoxymethyl acetate is sourced from PubChem (CID 14955603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).