C10H19N3 — CID 14955795
3,5-dibutyl-1H-1,2,4-triazole (PubChem CID 14955795) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 3,5-dibutyl-1H-1,2,4-triazole.
| Compound Name | 3,5-dibutyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 14955795 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 3,5-dibutyl-1H-1,2,4-triazole |
| SMILES | CCCCc1n[nH]c(CCCC)n1 |
| InChI | InChI=1S/C10H19N3/c1-3-5-7-9-11-10(13-12-9)8-6-4-2/h3-8H2,1-2H3,(H,11,12,13) |
| InChIKey | QONZJNWWQDCGEZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |