About 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one
3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one (PubChem CID 14955843) has the molecular formula C15H17ClO3S2
and a molecular weight of 344.89 g/mol. Its IUPAC name is 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one.
Molecular Properties
| Compound Name | 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one |
| PubChem CID | 14955843 |
| Molecular Formula | C15H17ClO3S2 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one |
| SMILES | CC(C)(C)C(CCl)SC1=CS(=O)(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17ClO3S2/c1-15(2,3)13(8-16)20-11-9-21(18,19)12-7-5-4-6-10(12)14(11)17/h4-7,9,13H,8H2,1-3H3 |
| InChIKey | VKCNVNBWRLJROW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one?
The IUPAC name of 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one (CID 14955843) is 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one.
What is the SMILES notation for 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one?
The canonical SMILES for 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one is CC(C)(C)C(CCl)SC1=CS(=O)(=O)c2ccccc2C1=O.
What is the InChIKey of 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one?
The InChIKey is VKCNVNBWRLJROW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClO3S2/c1-15(2,3)13(8-16)20-11-9-21(18,19)12-7-5-4-6-10(12)14(11)17/h4-7,9,13H,8H2,1-3H3.
What are the key properties of 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one?
3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one has a molecular weight of 344.89 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-chloro-3,3-dimethylbutan-2-yl)sulfanyl-1,1-dioxothiochromen-4-one is sourced from PubChem (CID 14955843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).