C16H16N2 — CID 14956433
3-(4-methylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazole (PubChem CID 14956433) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-(4-methylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazole.
| Compound Name | 3-(4-methylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 14956433 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-(4-methylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazole |
| SMILES | Cc1ccc(C2=NNC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C16H16N2/c1-12-7-9-14(10-8-12)16-11-15(17-18-16)13-5-3-2-4-6-13/h2-10,15,17H,11H2,1H3 |
| InChIKey | QOEWBUDBFAOTSS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |