About 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide
2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide (PubChem CID 14956442) has the molecular formula C19H14FN3O3
and a molecular weight of 351.34 g/mol. Its IUPAC name is 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide.
Molecular Properties
| Compound Name | 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide |
| PubChem CID | 14956442 |
| Molecular Formula | C19H14FN3O3 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide |
| SMILES | O=C(NN(c1ccccc1)c1ccccc1)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C19H14FN3O3/c20-18-12-11-16(23(25)26)13-17(18)19(24)21-22(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H,(H,21,24) |
| InChIKey | NRYBBXMPBSGBHR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide?
The IUPAC name of 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide (CID 14956442) is 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide.
What is the SMILES notation for 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide?
The canonical SMILES for 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide is O=C(NN(c1ccccc1)c1ccccc1)c1cc([N+](=O)[O-])ccc1F.
What is the InChIKey of 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide?
The InChIKey is NRYBBXMPBSGBHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14FN3O3/c20-18-12-11-16(23(25)26)13-17(18)19(24)21-22(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H,(H,21,24).
What are the key properties of 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide?
2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide has a molecular weight of 351.34 g/mol, XLogP of 4.22, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-nitro-N',N'-diphenylbenzohydrazide is sourced from PubChem (CID 14956442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).