About 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione
3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione (PubChem CID 14956866) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione.
Molecular Properties
| Compound Name | 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione |
| PubChem CID | 14956866 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1CCC2(CC1)OC(=O)N(C)C2=O |
| InChI | InChI=1S/C9H14N2O3/c1-10-5-3-9(4-6-10)7(12)11(2)8(13)14-9/h3-6H2,1-2H3 |
| InChIKey | RQEQFQKXTSPEBQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione?
The IUPAC name of 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione (CID 14956866) is 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione.
What is the SMILES notation for 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione?
The canonical SMILES for 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione is CN1CCC2(CC1)OC(=O)N(C)C2=O.
What is the InChIKey of 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione?
The InChIKey is RQEQFQKXTSPEBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-10-5-3-9(4-6-10)7(12)11(2)8(13)14-9/h3-6H2,1-2H3.
What are the key properties of 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione?
3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione has a molecular weight of 198.22 g/mol, XLogP of 0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethyl-1-oxa-3,8-diazaspiro[4.5]decane-2,4-dione is sourced from PubChem (CID 14956866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).