About 6-fluorotricyclo[3.2.1.03,6]octane
6-fluorotricyclo[3.2.1.03,6]octane (PubChem CID 14958268) has the molecular formula C8H11F
and a molecular weight of 126.17 g/mol. Its IUPAC name is 6-fluorotricyclo[3.2.1.03,6]octane.
Molecular Properties
| Compound Name | 6-fluorotricyclo[3.2.1.03,6]octane |
| PubChem CID | 14958268 |
| Molecular Formula | C8H11F |
| Molecular Weight | 126.17 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 6-fluorotricyclo[3.2.1.03,6]octane |
| SMILES | FC12CC3CC1CC2C3 |
| InChI | InChI=1S/C8H11F/c9-8-4-5-1-6(8)3-7(8)2-5/h5-7H,1-4H2 |
| InChIKey | AOSUZQACSUCKPC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-fluorotricyclo[3.2.1.03,6]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorotricyclo[3.2.1.03,6]octane?
The IUPAC name of 6-fluorotricyclo[3.2.1.03,6]octane (CID 14958268) is 6-fluorotricyclo[3.2.1.03,6]octane.
What is the SMILES notation for 6-fluorotricyclo[3.2.1.03,6]octane?
The canonical SMILES for 6-fluorotricyclo[3.2.1.03,6]octane is FC12CC3CC1CC2C3.
What is the InChIKey of 6-fluorotricyclo[3.2.1.03,6]octane?
The InChIKey is AOSUZQACSUCKPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F/c9-8-4-5-1-6(8)3-7(8)2-5/h5-7H,1-4H2.
What are the key properties of 6-fluorotricyclo[3.2.1.03,6]octane?
6-fluorotricyclo[3.2.1.03,6]octane has a molecular weight of 126.17 g/mol, XLogP of 2.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorotricyclo[3.2.1.03,6]octane is sourced from PubChem (CID 14958268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).