About CID 14958271
CID 14958271 (PubChem CID 14958271) has the molecular formula C8H7+
and a molecular weight of 103.14 g/mol.
Molecular Properties
| Compound Name | CID 14958271 |
| PubChem CID | 14958271 |
| Molecular Formula | C8H7+ |
| Molecular Weight | 103.14 g/mol |
| Exact Mass | 103.05 |
| IUPAC Name | — |
| SMILES | [C+]12C3C4C1C1C2C3C41 |
| InChI | InChI=1S/C8H7/c1-2-5-3(1)7-4(1)6(2)8(5)7/h1-7H/q+1 |
| InChIKey | NKDFVYJXVLTFJA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.14 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 14958271 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 14958271?
The IUPAC name of CID 14958271 (CID 14958271) is not available.
What is the SMILES notation for CID 14958271?
The canonical SMILES for CID 14958271 is [C+]12C3C4C1C1C2C3C41.
What is the InChIKey of CID 14958271?
The InChIKey is NKDFVYJXVLTFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7/c1-2-5-3(1)7-4(1)6(2)8(5)7/h1-7H/q+1.
What are the key properties of CID 14958271?
CID 14958271 has a molecular weight of 103.14 g/mol, XLogP of 0.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 14958271 is sourced from PubChem (CID 14958271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).