C25H27N3O — CID 14960357
3,3-diphenyl-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]propan-1-one (PubChem CID 14960357) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is 3,3-diphenyl-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3,3-diphenyl-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 14960357 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 3,3-diphenyl-1-[4-(pyridin-2-ylmethyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C25H27N3O/c29-25(28-17-15-27(16-18-28)20-23-13-7-8-14-26-23)19-24(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-14,24H,15-20H2 |
| InChIKey | DYBZZIRKHBMPMP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |