About zinc;ethane;ethenylcyclohexane
zinc;ethane;ethenylcyclohexane (PubChem CID 14961439) has the molecular formula C10H18Zn
and a molecular weight of 203.64 g/mol. Its IUPAC name is zinc;ethane;ethenylcyclohexane.
Molecular Properties
| Compound Name | zinc;ethane;ethenylcyclohexane |
|---|
| PubChem CID | 14961439 |
|---|
| Molecular Formula | C10H18Zn |
|---|
| Molecular Weight | 203.64 g/mol |
|---|
| Exact Mass | 202.07 |
|---|
| IUPAC Name | zinc;ethane;ethenylcyclohexane |
|---|
| SMILES | [CH2-]C.[H]/[C-]=C\C1CCCCC1.[Zn+2] |
|---|
| InChI | InChI=1S/C8H13.C2H5.Zn/c1-2-8-6-4-3-5-7-8;1-2;/h1-2,8H,3-7H2;1H2,2H3;/q2*-1;+2 |
|---|
| InChIKey | RIHAATHEFCYLAJ-UHFFFAOYSA-N |
|---|
| XLogP | 3.39 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 1 |
|---|
| Heavy Atoms | 11 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 203.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;ethane;ethenylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;ethane;ethenylcyclohexane?
The IUPAC name of zinc;ethane;ethenylcyclohexane (CID 14961439) is zinc;ethane;ethenylcyclohexane.
What is the SMILES notation for zinc;ethane;ethenylcyclohexane?
The canonical SMILES for zinc;ethane;ethenylcyclohexane is [CH2-]C.[H]/[C-]=C\C1CCCCC1.[Zn+2].
What is the InChIKey of zinc;ethane;ethenylcyclohexane?
The InChIKey is RIHAATHEFCYLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13.C2H5.Zn/c1-2-8-6-4-3-5-7-8;1-2;/h1-2,8H,3-7H2;1H2,2H3;/q2*-1;+2.
What are the key properties of zinc;ethane;ethenylcyclohexane?
zinc;ethane;ethenylcyclohexane has a molecular weight of 203.64 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;ethane;ethenylcyclohexane is sourced from PubChem (CID 14961439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).