About zinc;carbanide;ethenylcyclohexane
zinc;carbanide;ethenylcyclohexane (PubChem CID 14961440) has the molecular formula C9H16Zn
and a molecular weight of 189.62 g/mol. Its IUPAC name is zinc;carbanide;ethenylcyclohexane.
Molecular Properties
| Compound Name | zinc;carbanide;ethenylcyclohexane |
| PubChem CID | 14961440 |
| Molecular Formula | C9H16Zn |
| Molecular Weight | 189.62 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | zinc;carbanide;ethenylcyclohexane |
| SMILES | [CH3-].[H]/[C-]=C\C1CCCCC1.[Zn+2] |
| InChI | InChI=1S/C8H13.CH3.Zn/c1-2-8-6-4-3-5-7-8;;/h1-2,8H,3-7H2;1H3;/q2*-1;+2 |
| InChIKey | DPCOFTFSRDCAPG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;carbanide;ethenylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;carbanide;ethenylcyclohexane?
The IUPAC name of zinc;carbanide;ethenylcyclohexane (CID 14961440) is zinc;carbanide;ethenylcyclohexane.
What is the SMILES notation for zinc;carbanide;ethenylcyclohexane?
The canonical SMILES for zinc;carbanide;ethenylcyclohexane is [CH3-].[H]/[C-]=C\C1CCCCC1.[Zn+2].
What is the InChIKey of zinc;carbanide;ethenylcyclohexane?
The InChIKey is DPCOFTFSRDCAPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13.CH3.Zn/c1-2-8-6-4-3-5-7-8;;/h1-2,8H,3-7H2;1H3;/q2*-1;+2.
What are the key properties of zinc;carbanide;ethenylcyclohexane?
zinc;carbanide;ethenylcyclohexane has a molecular weight of 189.62 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;carbanide;ethenylcyclohexane is sourced from PubChem (CID 14961440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).