C14H15N3O3S2 — CID 1496159
1-(2,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)thiourea (PubChem CID 1496159) has the molecular formula C14H15N3O3S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)thiourea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 1496159 |
| Molecular Formula | C14H15N3O3S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(thiophene-2-carbonylamino)thiourea |
| SMILES | COc1ccc(NC(=S)NNC(=O)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C14H15N3O3S2/c1-19-9-5-6-10(11(8-9)20-2)15-14(21)17-16-13(18)12-4-3-7-22-12/h3-8H,1-2H3,(H,16,18)(H2,15,17,21) |
| InChIKey | FFPICOIDDVBDCQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|