About 3-methyl-3-propa-1,2-dienoxycyclohexene
3-methyl-3-propa-1,2-dienoxycyclohexene (PubChem CID 14961645) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-methyl-3-propa-1,2-dienoxycyclohexene.
Molecular Properties
| Compound Name | 3-methyl-3-propa-1,2-dienoxycyclohexene |
| PubChem CID | 14961645 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 3-methyl-3-propa-1,2-dienoxycyclohexene |
| SMILES | C=C=COC1(C)C=CCCC1 |
| InChI | InChI=1S/C10H14O/c1-3-9-11-10(2)7-5-4-6-8-10/h5,7,9H,1,4,6,8H2,2H3 |
| InChIKey | FQOAOCVSVBWWSS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-propa-1,2-dienoxycyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-propa-1,2-dienoxycyclohexene?
The IUPAC name of 3-methyl-3-propa-1,2-dienoxycyclohexene (CID 14961645) is 3-methyl-3-propa-1,2-dienoxycyclohexene.
What is the SMILES notation for 3-methyl-3-propa-1,2-dienoxycyclohexene?
The canonical SMILES for 3-methyl-3-propa-1,2-dienoxycyclohexene is C=C=COC1(C)C=CCCC1.
What is the InChIKey of 3-methyl-3-propa-1,2-dienoxycyclohexene?
The InChIKey is FQOAOCVSVBWWSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-3-9-11-10(2)7-5-4-6-8-10/h5,7,9H,1,4,6,8H2,2H3.
What are the key properties of 3-methyl-3-propa-1,2-dienoxycyclohexene?
3-methyl-3-propa-1,2-dienoxycyclohexene has a molecular weight of 150.22 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-propa-1,2-dienoxycyclohexene is sourced from PubChem (CID 14961645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).