C22H19FN2O4S — CID 1496173
ethyl 5-[(4-fluorobenzoyl)amino]-3-methyl-4-(phenylcarbamoyl)thiophene-2-carboxylate (PubChem CID 1496173) has the molecular formula C22H19FN2O4S and a molecular weight of 426.47 g/mol. Its IUPAC name is ethyl 5-[(4-fluorobenzoyl)amino]-3-methyl-4-(phenylcarbamoyl)thiophene-2-carboxylate.
| Compound Name | ethyl 5-[(4-fluorobenzoyl)amino]-3-methyl-4-(phenylcarbamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1496173 |
| Molecular Formula | C22H19FN2O4S |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | ethyl 5-[(4-fluorobenzoyl)amino]-3-methyl-4-(phenylcarbamoyl)thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(F)cc2)c(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C22H19FN2O4S/c1-3-29-22(28)18-13(2)17(20(27)24-16-7-5-4-6-8-16)21(30-18)25-19(26)14-9-11-15(23)12-10-14/h4-12H,3H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | XCDLOAKBRCAVCL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |