About 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one
6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one (PubChem CID 14962068) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one.
Molecular Properties
| Compound Name | 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one |
| PubChem CID | 14962068 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one |
| SMILES | CC1(C)OC(=O)C=C(CCCCCCO)O1 |
| InChI | InChI=1S/C12H20O4/c1-12(2)15-10(9-11(14)16-12)7-5-3-4-6-8-13/h9,13H,3-8H2,1-2H3 |
| InChIKey | SKXLPVRTMNNJPX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one?
The IUPAC name of 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one (CID 14962068) is 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one.
What is the SMILES notation for 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one?
The canonical SMILES for 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one is CC1(C)OC(=O)C=C(CCCCCCO)O1.
What is the InChIKey of 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one?
The InChIKey is SKXLPVRTMNNJPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-12(2)15-10(9-11(14)16-12)7-5-3-4-6-8-13/h9,13H,3-8H2,1-2H3.
What are the key properties of 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one?
6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one has a molecular weight of 228.29 g/mol, XLogP of 2.12, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-hydroxyhexyl)-2,2-dimethyl-1,3-dioxin-4-one is sourced from PubChem (CID 14962068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).