About 1-anilino-3-ethyl-2,6-dimethylindol-5-ol
1-anilino-3-ethyl-2,6-dimethylindol-5-ol (PubChem CID 14962174) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-anilino-3-ethyl-2,6-dimethylindol-5-ol.
Molecular Properties
| Compound Name | 1-anilino-3-ethyl-2,6-dimethylindol-5-ol |
| PubChem CID | 14962174 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-anilino-3-ethyl-2,6-dimethylindol-5-ol |
| SMILES | CCc1c(C)n(Nc2ccccc2)c2cc(C)c(O)cc12 |
| InChI | InChI=1S/C18H20N2O/c1-4-15-13(3)20(19-14-8-6-5-7-9-14)17-10-12(2)18(21)11-16(15)17/h5-11,19,21H,4H2,1-3H3 |
| InChIKey | MQBQNUIRYAPFHL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-anilino-3-ethyl-2,6-dimethylindol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilino-3-ethyl-2,6-dimethylindol-5-ol?
The IUPAC name of 1-anilino-3-ethyl-2,6-dimethylindol-5-ol (CID 14962174) is 1-anilino-3-ethyl-2,6-dimethylindol-5-ol.
What is the SMILES notation for 1-anilino-3-ethyl-2,6-dimethylindol-5-ol?
The canonical SMILES for 1-anilino-3-ethyl-2,6-dimethylindol-5-ol is CCc1c(C)n(Nc2ccccc2)c2cc(C)c(O)cc12.
What is the InChIKey of 1-anilino-3-ethyl-2,6-dimethylindol-5-ol?
The InChIKey is MQBQNUIRYAPFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O/c1-4-15-13(3)20(19-14-8-6-5-7-9-14)17-10-12(2)18(21)11-16(15)17/h5-11,19,21H,4H2,1-3H3.
What are the key properties of 1-anilino-3-ethyl-2,6-dimethylindol-5-ol?
1-anilino-3-ethyl-2,6-dimethylindol-5-ol has a molecular weight of 280.37 g/mol, XLogP of 4.40, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilino-3-ethyl-2,6-dimethylindol-5-ol is sourced from PubChem (CID 14962174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).