About methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate
methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate (PubChem CID 14962244) has the molecular formula C6H7ClN2O2S
and a molecular weight of 206.65 g/mol. Its IUPAC name is methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate |
| PubChem CID | 14962244 |
| Molecular Formula | C6H7ClN2O2S |
| Molecular Weight | 206.65 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc(CCl)cs1 |
| InChI | InChI=1S/C6H7ClN2O2S/c1-11-6(10)9-5-8-4(2-7)3-12-5/h3H,2H2,1H3,(H,8,9,10) |
| InChIKey | JYJARJPJGQRQGO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.65 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate?
The IUPAC name of methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate (CID 14962244) is methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate.
What is the SMILES notation for methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate?
The canonical SMILES for methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate is COC(=O)Nc1nc(CCl)cs1.
What is the InChIKey of methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate?
The InChIKey is JYJARJPJGQRQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2S/c1-11-6(10)9-5-8-4(2-7)3-12-5/h3H,2H2,1H3,(H,8,9,10).
What are the key properties of methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate?
methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate has a molecular weight of 206.65 g/mol, XLogP of 2.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[4-(chloromethyl)-1,3-thiazol-2-yl]carbamate is sourced from PubChem (CID 14962244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).