C7H4F3N3OS2 — CID 14962266
2,2,2-trifluoro-N-[4-(isothiocyanatomethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 14962266) has the molecular formula C7H4F3N3OS2 and a molecular weight of 267.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-(isothiocyanatomethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-(isothiocyanatomethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 14962266 |
| Molecular Formula | C7H4F3N3OS2 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-(isothiocyanatomethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(Nc1nc(CN=C=S)cs1)C(F)(F)F |
| InChI | InChI=1S/C7H4F3N3OS2/c8-7(9,10)5(14)13-6-12-4(2-16-6)1-11-3-15/h2H,1H2,(H,12,13,14) |
| InChIKey | CFRDQHDDUYLBRE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|