About 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one
3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one (PubChem CID 14963379) has the molecular formula C15H18N2O4
and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one |
| PubChem CID | 14963379 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one |
| SMILES | COc1cc(CCc2ccc(=O)[nH]n2)cc(OC)c1OC |
| InChI | InChI=1S/C15H18N2O4/c1-19-12-8-10(9-13(20-2)15(12)21-3)4-5-11-6-7-14(18)17-16-11/h6-9H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | FVGYUBONAUARGA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one?
The IUPAC name of 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one (CID 14963379) is 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one.
What is the SMILES notation for 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one?
The canonical SMILES for 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one is COc1cc(CCc2ccc(=O)[nH]n2)cc(OC)c1OC.
What is the InChIKey of 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one?
The InChIKey is FVGYUBONAUARGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4/c1-19-12-8-10(9-13(20-2)15(12)21-3)4-5-11-6-7-14(18)17-16-11/h6-9H,4-5H2,1-3H3,(H,17,18).
What are the key properties of 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one?
3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one has a molecular weight of 290.32 g/mol, XLogP of 1.58, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4,5-trimethoxyphenyl)ethyl]-1H-pyridazin-6-one is sourced from PubChem (CID 14963379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).