C6H7F7O2 — CID 14963555
2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethanol (PubChem CID 14963555) has the molecular formula C6H7F7O2 and a molecular weight of 244.11 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethanol.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethanol |
|---|---|
| PubChem CID | 14963555 |
| Molecular Formula | C6H7F7O2 |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethanol |
| SMILES | OCCOCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F7O2/c7-4(8,3-15-2-1-14)5(9,10)6(11,12)13/h14H,1-3H2 |
| InChIKey | TZDLXSQBIYOTMV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|