C8H11F7O3 — CID 14963557
2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethoxy]ethanol (PubChem CID 14963557) has the molecular formula C8H11F7O3 and a molecular weight of 288.16 g/mol. Its IUPAC name is 2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethoxy]ethanol.
| Compound Name | 2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 14963557 |
| Molecular Formula | C8H11F7O3 |
| Molecular Weight | 288.16 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)ethoxy]ethanol |
| SMILES | OCCOCCOCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F7O3/c9-6(10,7(11,12)8(13,14)15)5-18-4-3-17-2-1-16/h16H,1-5H2 |
| InChIKey | SDTPOMADHFFMFD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.16 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|