C33H32N2O4 — CID 14963849
N-[[(4S,5S)-5-[formamido(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]formamide (PubChem CID 14963849) has the molecular formula C33H32N2O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is N-[[(4S,5S)-5-[formamido(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]formamide.
| Compound Name | N-[[(4S,5S)-5-[formamido(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]formamide |
|---|---|
| PubChem CID | 14963849 |
| Molecular Formula | C33H32N2O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | N-[[(4S,5S)-5-[formamido(diphenyl)methyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-diphenylmethyl]formamide |
| SMILES | CC1(C)O[C@@H](C(NC=O)(c2ccccc2)c2ccccc2)[C@H](C(NC=O)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C33H32N2O4/c1-31(2)38-29(32(34-23-36,25-15-7-3-8-16-25)26-17-9-4-10-18-26)30(39-31)33(35-24-37,27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-24,29-30H,1-2H3,(H,34,36)(H,35,37)/t29-,30-/m1/s1 |
| InChIKey | HWXLNOGFUUQBNM-LOYHVIPDSA-N |
| XLogP | 4.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|