About 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole
2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole (PubChem CID 14964721) has the molecular formula C9H12N2O
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole |
| PubChem CID | 14964721 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole |
| SMILES | Cc1cc(C2=NCCN2)c(C)o1 |
| InChI | InChI=1S/C9H12N2O/c1-6-5-8(7(2)12-6)9-10-3-4-11-9/h5H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | YXYWBIKDCIYQFF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole (CID 14964721) is 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole is Cc1cc(C2=NCCN2)c(C)o1.
What is the InChIKey of 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole?
The InChIKey is YXYWBIKDCIYQFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O/c1-6-5-8(7(2)12-6)9-10-3-4-11-9/h5H,3-4H2,1-2H3,(H,10,11).
What are the key properties of 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole?
2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole has a molecular weight of 164.21 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethylfuran-3-yl)-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 14964721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).