About N-(2,2-difluoroethyl)aniline
N-(2,2-difluoroethyl)aniline (PubChem CID 14965076) has the molecular formula C8H9F2N
and a molecular weight of 157.16 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)aniline.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)aniline |
| PubChem CID | 14965076 |
| Molecular Formula | C8H9F2N |
| Molecular Weight | 157.16 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N-(2,2-difluoroethyl)aniline |
| SMILES | FC(F)CNc1ccccc1 |
| InChI | InChI=1S/C8H9F2N/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5,8,11H,6H2 |
| InChIKey | MLBYYTORZPAXDZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,2-difluoroethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)aniline?
The IUPAC name of N-(2,2-difluoroethyl)aniline (CID 14965076) is N-(2,2-difluoroethyl)aniline.
What is the SMILES notation for N-(2,2-difluoroethyl)aniline?
The canonical SMILES for N-(2,2-difluoroethyl)aniline is FC(F)CNc1ccccc1.
What is the InChIKey of N-(2,2-difluoroethyl)aniline?
The InChIKey is MLBYYTORZPAXDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2N/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5,8,11H,6H2.
What are the key properties of N-(2,2-difluoroethyl)aniline?
N-(2,2-difluoroethyl)aniline has a molecular weight of 157.16 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)aniline is sourced from PubChem (CID 14965076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).