C8H8Cl4N2 — CID 14965129
2,3,5,6-tetrachloro-N-propylpyridin-4-amine (PubChem CID 14965129) has the molecular formula C8H8Cl4N2 and a molecular weight of 273.98 g/mol. Its IUPAC name is 2,3,5,6-tetrachloro-N-propylpyridin-4-amine.
| Compound Name | 2,3,5,6-tetrachloro-N-propylpyridin-4-amine |
|---|---|
| PubChem CID | 14965129 |
| Molecular Formula | C8H8Cl4N2 |
| Molecular Weight | 273.98 g/mol |
| Exact Mass | 271.94 |
| IUPAC Name | 2,3,5,6-tetrachloro-N-propylpyridin-4-amine |
| SMILES | CCCNc1c(Cl)c(Cl)nc(Cl)c1Cl |
| InChI | InChI=1S/C8H8Cl4N2/c1-2-3-13-6-4(9)7(11)14-8(12)5(6)10/h2-3H2,1H3,(H,13,14) |
| InChIKey | ZGVKPKFBSIOJLJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.98 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|