About 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine
4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine (PubChem CID 14965131) has the molecular formula C10H8Cl3F3N2OS
and a molecular weight of 367.61 g/mol. Its IUPAC name is 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine.
Molecular Properties
| Compound Name | 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine |
| PubChem CID | 14965131 |
| Molecular Formula | C10H8Cl3F3N2OS |
| Molecular Weight | 367.61 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine |
| SMILES | FC(F)(F)Sc1c(Cl)c(Cl)nc(N2CCOCC2)c1Cl |
| InChI | InChI=1S/C10H8Cl3F3N2OS/c11-5-7(20-10(14,15)16)6(12)9(17-8(5)13)18-1-3-19-4-2-18/h1-4H2 |
| InChIKey | XZYQXPRTNPGEOO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.61 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine?
The IUPAC name of 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine (CID 14965131) is 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine.
What is the SMILES notation for 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine?
The canonical SMILES for 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine is FC(F)(F)Sc1c(Cl)c(Cl)nc(N2CCOCC2)c1Cl.
What is the InChIKey of 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine?
The InChIKey is XZYQXPRTNPGEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl3F3N2OS/c11-5-7(20-10(14,15)16)6(12)9(17-8(5)13)18-1-3-19-4-2-18/h1-4H2.
What are the key properties of 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine?
4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine has a molecular weight of 367.61 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,5,6-trichloro-4-(trifluoromethylsulfanyl)-2-pyridinyl]morpholine is sourced from PubChem (CID 14965131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).