About 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate
2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate (PubChem CID 14965354) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate.
Molecular Properties
| Compound Name | 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate |
| PubChem CID | 14965354 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)C1=CC=C(C)CC1 |
| InChI | InChI=1S/C12H18O2/c1-9-5-7-11(8-6-9)12(3,4)14-10(2)13/h5,7H,6,8H2,1-4H3 |
| InChIKey | VXKRWBIGERJLPR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate?
The IUPAC name of 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate (CID 14965354) is 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate.
What is the SMILES notation for 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate?
The canonical SMILES for 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate is CC(=O)OC(C)(C)C1=CC=C(C)CC1.
What is the InChIKey of 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate?
The InChIKey is VXKRWBIGERJLPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-9-5-7-11(8-6-9)12(3,4)14-10(2)13/h5,7H,6,8H2,1-4H3.
What are the key properties of 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate?
2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate has a molecular weight of 194.27 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylcyclohexa-1,3-dien-1-yl)propan-2-yl acetate is sourced from PubChem (CID 14965354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).