C29H25BrN2O5 — CID 1496540
(5R)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione (PubChem CID 1496540) has the molecular formula C29H25BrN2O5 and a molecular weight of 561.43 g/mol. Its IUPAC name is (5R)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 1496540 |
| Molecular Formula | C29H25BrN2O5 |
| Molecular Weight | 561.43 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | (5R)-4-[(4-bromophenyl)-hydroxymethylidene]-5-(3-ethoxy-4-hydroxyphenyl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@@H]2C(=C(O)c3ccc(Br)cc3)C(=O)C(=O)N2CCc2c[nH]c3ccccc23)ccc1O |
| InChI | InChI=1S/C29H25BrN2O5/c1-2-37-24-15-18(9-12-23(24)33)26-25(27(34)17-7-10-20(30)11-8-17)28(35)29(36)32(26)14-13-19-16-31-22-6-4-3-5-21(19)22/h3-12,15-16,26,31,33-34H,2,13-14H2,1H3/t26-/m1/s1 |
| InChIKey | SLPOPYCAIGKOHG-AREMUKBSSA-N |
| XLogP | 5.70 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.43 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|