C21H25NO2 — CID 14965640
(2S,3S)-2-(dibenzylamino)-4-methoxyhexa-4,5-dien-3-ol (PubChem CID 14965640) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S,3S)-2-(dibenzylamino)-4-methoxyhexa-4,5-dien-3-ol.
| Compound Name | (2S,3S)-2-(dibenzylamino)-4-methoxyhexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 14965640 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (2S,3S)-2-(dibenzylamino)-4-methoxyhexa-4,5-dien-3-ol |
| SMILES | C=C=C(OC)[C@@H](O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-4-20(24-3)21(23)17(2)22(15-18-11-7-5-8-12-18)16-19-13-9-6-10-14-19/h5-14,17,21,23H,1,15-16H2,2-3H3/t17-,21-/m0/s1 |
| InChIKey | PBXPQGYDFWZINN-UWJYYQICSA-N |
| XLogP | 3.75 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|