About (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol
(2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol (PubChem CID 14965644) has the molecular formula C27H29NO2
and a molecular weight of 399.53 g/mol. Its IUPAC name is (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol.
Molecular Properties
| Compound Name | (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol |
| PubChem CID | 14965644 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol |
| SMILES | C=C=C(OC)[C@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H29NO2/c1-3-26(30-2)27(29)25(19-22-13-7-4-8-14-22)28(20-23-15-9-5-10-16-23)21-24-17-11-6-12-18-24/h4-18,25,27,29H,1,19-21H2,2H3/t25-,27+/m0/s1 |
| InChIKey | GYZDTPDYRIGYBK-AHKZPQOWSA-N |
| XLogP | 4.98 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol?
The IUPAC name of (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol (CID 14965644) is (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol.
What is the SMILES notation for (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol?
The canonical SMILES for (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol is C=C=C(OC)[C@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol?
The InChIKey is GYZDTPDYRIGYBK-AHKZPQOWSA-N. The full InChI is InChI=1S/C27H29NO2/c1-3-26(30-2)27(29)25(19-22-13-7-4-8-14-22)28(20-23-15-9-5-10-16-23)21-24-17-11-6-12-18-24/h4-18,25,27,29H,1,19-21H2,2H3/t25-,27+/m0/s1.
What are the key properties of (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol?
(2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol has a molecular weight of 399.53 g/mol, XLogP of 4.98, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-(dibenzylamino)-4-methoxy-1-phenylhexa-4,5-dien-3-ol is sourced from PubChem (CID 14965644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).