C30H26N2O6 — CID 1496621
methyl 4-[(2S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-[2-(1H-indol-3-yl)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 1496621) has the molecular formula C30H26N2O6 and a molecular weight of 510.55 g/mol. Its IUPAC name is methyl 4-[(2S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-[2-(1H-indol-3-yl)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-[2-(1H-indol-3-yl)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 1496621 |
| Molecular Formula | C30H26N2O6 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | methyl 4-[(2S)-3-[hydroxy-(4-methoxyphenyl)methylidene]-1-[2-(1H-indol-3-yl)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2C(=C(O)c3ccc(OC)cc3)C(=O)C(=O)N2CCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C30H26N2O6/c1-37-22-13-11-19(12-14-22)27(33)25-26(18-7-9-20(10-8-18)30(36)38-2)32(29(35)28(25)34)16-15-21-17-31-24-6-4-3-5-23(21)24/h3-14,17,26,31,33H,15-16H2,1-2H3/t26-/m0/s1 |
| InChIKey | HVRCDEPNQMYEGZ-SANMLTNESA-N |
| XLogP | 4.63 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|