About 2-(benzylamino)propane-1,3-diol
2-(benzylamino)propane-1,3-diol (PubChem CID 14967214) has the molecular formula C10H15NO2
and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-(benzylamino)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(benzylamino)propane-1,3-diol |
| PubChem CID | 14967214 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2-(benzylamino)propane-1,3-diol |
| SMILES | OCC(CO)NCc1ccccc1 |
| InChI | InChI=1S/C10H15NO2/c12-7-10(8-13)11-6-9-4-2-1-3-5-9/h1-5,10-13H,6-8H2 |
| InChIKey | VTZUQTNKNVREQW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzylamino)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzylamino)propane-1,3-diol?
The IUPAC name of 2-(benzylamino)propane-1,3-diol (CID 14967214) is 2-(benzylamino)propane-1,3-diol.
What is the SMILES notation for 2-(benzylamino)propane-1,3-diol?
The canonical SMILES for 2-(benzylamino)propane-1,3-diol is OCC(CO)NCc1ccccc1.
What is the InChIKey of 2-(benzylamino)propane-1,3-diol?
The InChIKey is VTZUQTNKNVREQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c12-7-10(8-13)11-6-9-4-2-1-3-5-9/h1-5,10-13H,6-8H2.
What are the key properties of 2-(benzylamino)propane-1,3-diol?
2-(benzylamino)propane-1,3-diol has a molecular weight of 181.24 g/mol, XLogP of 0.13, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylamino)propane-1,3-diol is sourced from PubChem (CID 14967214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).