C16H21NO3 — CID 14967218
[(3S,6S)-4-benzyl-6-ethenylmorpholin-3-yl]methyl acetate (PubChem CID 14967218) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is [(3S,6S)-4-benzyl-6-ethenylmorpholin-3-yl]methyl acetate.
| Compound Name | [(3S,6S)-4-benzyl-6-ethenylmorpholin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 14967218 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | [(3S,6S)-4-benzyl-6-ethenylmorpholin-3-yl]methyl acetate |
| SMILES | C=C[C@H]1CN(Cc2ccccc2)[C@H](COC(C)=O)CO1 |
| InChI | InChI=1S/C16H21NO3/c1-3-16-10-17(9-14-7-5-4-6-8-14)15(12-20-16)11-19-13(2)18/h3-8,15-16H,1,9-12H2,2H3/t15-,16+/m1/s1 |
| InChIKey | YIAJNBSLUQDFID-CVEARBPZSA-N |
| XLogP | 2.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|