C17H18O8 — CID 14967711
tetramethyl tricyclo[3.3.1.02,8]nona-3,6-diene-2,4,6,8-tetracarboxylate (PubChem CID 14967711) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is tetramethyl tricyclo[3.3.1.02,8]nona-3,6-diene-2,4,6,8-tetracarboxylate.
| Compound Name | tetramethyl tricyclo[3.3.1.02,8]nona-3,6-diene-2,4,6,8-tetracarboxylate |
|---|---|
| PubChem CID | 14967711 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | tetramethyl tricyclo[3.3.1.02,8]nona-3,6-diene-2,4,6,8-tetracarboxylate |
| SMILES | COC(=O)C1=CC2(C(=O)OC)C3CC1C(C(=O)OC)=CC32C(=O)OC |
| InChI | InChI=1S/C17H18O8/c1-22-12(18)9-6-16(14(20)24-3)11-5-8(9)10(13(19)23-2)7-17(11,16)15(21)25-4/h6-8,11H,5H2,1-4H3 |
| InChIKey | XXUDKZOXVBFHSJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|