C11H15ClN3O2P — CID 14968047
2-(2-chloroethylamino)-1,3-dimethyl-2-oxo-1,3,2lambda5-benzodiazaphosphinin-4-one (PubChem CID 14968047) has the molecular formula C11H15ClN3O2P and a molecular weight of 287.69 g/mol. Its IUPAC name is 2-(2-chloroethylamino)-1,3-dimethyl-2-oxo-1,3,2lambda5-benzodiazaphosphinin-4-one.
| Compound Name | 2-(2-chloroethylamino)-1,3-dimethyl-2-oxo-1,3,2lambda5-benzodiazaphosphinin-4-one |
|---|---|
| PubChem CID | 14968047 |
| Molecular Formula | C11H15ClN3O2P |
| Molecular Weight | 287.69 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-(2-chloroethylamino)-1,3-dimethyl-2-oxo-1,3,2lambda5-benzodiazaphosphinin-4-one |
| SMILES | CN1C(=O)c2ccccc2N(C)P1(=O)NCCCl |
| InChI | InChI=1S/C11H15ClN3O2P/c1-14-10-6-4-3-5-9(10)11(16)15(2)18(14,17)13-8-7-12/h3-6H,7-8H2,1-2H3,(H,13,17) |
| InChIKey | RQNKZBCBFTTXPG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.69 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|