C13H12F4O — CID 14968125
1,2,4,5-tetrafluoro-3-hex-1-ynyl-6-methoxybenzene (PubChem CID 14968125) has the molecular formula C13H12F4O and a molecular weight of 260.23 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-hex-1-ynyl-6-methoxybenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-hex-1-ynyl-6-methoxybenzene |
|---|---|
| PubChem CID | 14968125 |
| Molecular Formula | C13H12F4O |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-hex-1-ynyl-6-methoxybenzene |
| SMILES | CCCCC#Cc1c(F)c(F)c(OC)c(F)c1F |
| InChI | InChI=1S/C13H12F4O/c1-3-4-5-6-7-8-9(14)11(16)13(18-2)12(17)10(8)15/h3-5H2,1-2H3 |
| InChIKey | IHEYLLLFVDZZRX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|