C9H10F3NO — CID 14968210
2,2,2-trifluoro-1-(1-propan-2-ylpyrrol-3-yl)ethanone (PubChem CID 14968210) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1-propan-2-ylpyrrol-3-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(1-propan-2-ylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 14968210 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(1-propan-2-ylpyrrol-3-yl)ethanone |
| SMILES | CC(C)n1ccc(C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H10F3NO/c1-6(2)13-4-3-7(5-13)8(14)9(10,11)12/h3-6H,1-2H3 |
| InChIKey | FBXVXUMWNVIYIP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |