C19H12F6N2O2 — CID 14968247
3-[(N-[(E)-benzylideneamino]anilino)methylidene]-1,1,1,5,5,5-hexafluoropentane-2,4-dione (PubChem CID 14968247) has the molecular formula C19H12F6N2O2 and a molecular weight of 414.31 g/mol. Its IUPAC name is 3-[(N-[(E)-benzylideneamino]anilino)methylidene]-1,1,1,5,5,5-hexafluoropentane-2,4-dione.
| Compound Name | 3-[(N-[(E)-benzylideneamino]anilino)methylidene]-1,1,1,5,5,5-hexafluoropentane-2,4-dione |
|---|---|
| PubChem CID | 14968247 |
| Molecular Formula | C19H12F6N2O2 |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 3-[(N-[(E)-benzylideneamino]anilino)methylidene]-1,1,1,5,5,5-hexafluoropentane-2,4-dione |
| SMILES | O=C(C(=CN(/N=C/c1ccccc1)c1ccccc1)C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H12F6N2O2/c20-18(21,22)16(28)15(17(29)19(23,24)25)12-27(14-9-5-2-6-10-14)26-11-13-7-3-1-4-8-13/h1-12H/b26-11+ |
| InChIKey | MOSYIZSYKMFEQJ-KBKYJPHKSA-N |
| XLogP | 4.67 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|