C16H20F12OSi — CID 14968255
tert-butyl-[(2E,4Z)-5,6,6,7,7,8,8,9,9,10,10,10-dodecafluorodeca-2,4-dien-4-yl]oxy-dimethylsilane (PubChem CID 14968255) has the molecular formula C16H20F12OSi and a molecular weight of 484.40 g/mol. Its IUPAC name is tert-butyl-[(2E,4Z)-5,6,6,7,7,8,8,9,9,10,10,10-dodecafluorodeca-2,4-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2E,4Z)-5,6,6,7,7,8,8,9,9,10,10,10-dodecafluorodeca-2,4-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 14968255 |
| Molecular Formula | C16H20F12OSi |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | tert-butyl-[(2E,4Z)-5,6,6,7,7,8,8,9,9,10,10,10-dodecafluorodeca-2,4-dien-4-yl]oxy-dimethylsilane |
| SMILES | C/C=C/C(O[Si](C)(C)C(C)(C)C)=C(/F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H20F12OSi/c1-7-8-9(29-30(5,6)11(2,3)4)10(17)12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)28/h7-8H,1-6H3/b8-7+,10-9- |
| InChIKey | MMXDKZBVZDEEDX-GOJKSUSPSA-N |
| XLogP | 7.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|